C18H22O5 — CID 102247239
[(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate (PubChem CID 102247239) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102247239 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1=C[C@]2(C)OC(=O)[C@]13CCC[C@]31C=C[C@H]2O1 |
| InChI | InChI=1S/C18H22O5/c1-15(2,3)13(19)21-12-10-16(4)11-6-9-17(22-11)7-5-8-18(12,17)14(20)23-16/h6,9-11H,5,7-8H2,1-4H3/t11-,16+,17+,18+/m1/s1 |
| InChIKey | OVTDBTGDTXUMTN-SZZJOZGLSA-N |
| XLogP | 2.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|