C14H13F3O6S — CID 102247242
[(1S,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] trifluoromethanesulfonate (PubChem CID 102247242) has the molecular formula C14H13F3O6S and a molecular weight of 366.31 g/mol. Its IUPAC name is [(1S,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102247242 |
| Molecular Formula | C14H13F3O6S |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [(1S,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12C=C(OS(=O)(=O)C(F)(F)F)[C@@]3(CCC[C@]34C=C[C@H]1O4)C(=O)O2 |
| InChI | InChI=1S/C14H13F3O6S/c1-11-7-9(23-24(19,20)14(15,16)17)13(10(18)22-11)5-2-4-12(13)6-3-8(11)21-12/h3,6-8H,2,4-5H2,1H3/t8-,11+,12+,13+/m1/s1 |
| InChIKey | FLRCBTXGPKXXEV-YJRXYDGGSA-N |
| XLogP | 1.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|