C19H24O5 — CID 102247246
[(1R,5R,8S,9S)-8,9-dimethyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate (PubChem CID 102247246) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(1R,5R,8S,9S)-8,9-dimethyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,5R,8S,9S)-8,9-dimethyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102247246 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [(1R,5R,8S,9S)-8,9-dimethyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1=C[C@]2(C)OC(=O)[C@]13CCC[C@@]31C=C[C@]2(C)O1 |
| InChI | InChI=1S/C19H24O5/c1-15(2,3)13(20)22-12-11-17(5)16(4)9-10-18(24-16)7-6-8-19(12,18)14(21)23-17/h9-11H,6-8H2,1-5H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | VWHGXZQCEOSAIR-OKYOBFRVSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|