C5Cl6F2 — CID 102247570
1,1,2,4,5,5-hexachloro-3,3-difluoropenta-1,4-diene (PubChem CID 102247570) has the molecular formula C5Cl6F2 and a molecular weight of 310.77 g/mol. Its IUPAC name is 1,1,2,4,5,5-hexachloro-3,3-difluoropenta-1,4-diene.
| Compound Name | 1,1,2,4,5,5-hexachloro-3,3-difluoropenta-1,4-diene |
|---|---|
| PubChem CID | 102247570 |
| Molecular Formula | C5Cl6F2 |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 307.81 |
| IUPAC Name | 1,1,2,4,5,5-hexachloro-3,3-difluoropenta-1,4-diene |
| SMILES | FC(F)(C(Cl)=C(Cl)Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C5Cl6F2/c6-1(3(8)9)5(12,13)2(7)4(10)11 |
| InChIKey | DAEDSESFTSKAKS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |