About (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene
(5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene (PubChem CID 102247682) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene.
Molecular Properties
| Compound Name | (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene |
| PubChem CID | 102247682 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene |
| SMILES | C=CC(C/C=C/CCOC)CCOC |
| InChI | InChI=1S/C12H22O2/c1-4-12(9-11-14-3)8-6-5-7-10-13-2/h4-6,12H,1,7-11H2,2-3H3/b6-5+ |
| InChIKey | DTTNPYFVQVATEJ-AATRIKPKSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene?
The IUPAC name of (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene (CID 102247682) is (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene.
What is the SMILES notation for (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene?
The canonical SMILES for (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene is C=CC(C/C=C/CCOC)CCOC.
What is the InChIKey of (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene?
The InChIKey is DTTNPYFVQVATEJ-AATRIKPKSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-12(9-11-14-3)8-6-5-7-10-13-2/h4-6,12H,1,7-11H2,2-3H3/b6-5+.
What are the key properties of (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene?
(5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene has a molecular weight of 198.31 g/mol, XLogP of 2.81, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-8-methoxy-3-(2-methoxyethyl)octa-1,5-diene is sourced from PubChem (CID 102247682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).