C19H32OSi — CID 102247971
(2,6-ditert-butyl-4-ethenylphenoxy)-trimethylsilane (PubChem CID 102247971) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-ethenylphenoxy)-trimethylsilane.
| Compound Name | (2,6-ditert-butyl-4-ethenylphenoxy)-trimethylsilane |
|---|---|
| PubChem CID | 102247971 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2,6-ditert-butyl-4-ethenylphenoxy)-trimethylsilane |
| SMILES | C=Cc1cc(C(C)(C)C)c(O[Si](C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32OSi/c1-11-14-12-15(18(2,3)4)17(20-21(8,9)10)16(13-14)19(5,6)7/h11-13H,1H2,2-10H3 |
| InChIKey | RRBUAHQJTPBGSW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|