C15H18F9NO — CID 102248403
N-cyclohexyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide (PubChem CID 102248403) has the molecular formula C15H18F9NO and a molecular weight of 399.30 g/mol. Its IUPAC name is N-cyclohexyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide.
| Compound Name | N-cyclohexyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 102248403 |
| Molecular Formula | C15H18F9NO |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-cyclohexyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C15H18F9NO/c1-2-11(26)25(10-6-4-3-5-7-10)9-8-12(16,17)13(18,19)14(20,21)15(22,23)24/h2,10H,1,3-9H2 |
| InChIKey | RWBANHRIFOJANS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|