C10H16N6O — CID 102248514
N-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]-N,2-dimethylprop-2-enamide (PubChem CID 102248514) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is N-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]-N,2-dimethylprop-2-enamide.
| Compound Name | N-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 102248514 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | N-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C10H16N6O/c1-6(2)8(17)16(3)5-4-7-13-9(11)15-10(12)14-7/h1,4-5H2,2-3H3,(H4,11,12,13,14,15) |
| InChIKey | UZVBRAWOTWKZPN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|