C12H22O5 — CID 102249104
(1R,2R,3S,4R,5R)-2,3,4-triethoxy-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 102249104) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-2,3,4-triethoxy-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,2R,3S,4R,5R)-2,3,4-triethoxy-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 102249104 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (1R,2R,3S,4R,5R)-2,3,4-triethoxy-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | CCO[C@@H]1[C@@H](OCC)[C@@H]2OC[C@@H](O2)[C@H]1OCC |
| InChI | InChI=1S/C12H22O5/c1-4-13-9-8-7-16-12(17-8)11(15-6-3)10(9)14-5-2/h8-12H,4-7H2,1-3H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | DOFLJIJOEXKRSV-RMPHRYRLSA-N |
| XLogP | 0.96 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |