About 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide
4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 102249140) has the molecular formula C8H17O4P
and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide.
Molecular Properties
| Compound Name | 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide |
| PubChem CID | 102249140 |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1CCOP(=O)(OC(C)(C)C)O1 |
| InChI | InChI=1S/C8H17O4P/c1-7-5-6-10-13(9,11-7)12-8(2,3)4/h7H,5-6H2,1-4H3 |
| InChIKey | BNUJXKIVQMITBH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide?
The IUPAC name of 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide (CID 102249140) is 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide.
What is the SMILES notation for 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide?
The canonical SMILES for 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide is CC1CCOP(=O)(OC(C)(C)C)O1.
What is the InChIKey of 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide?
The InChIKey is BNUJXKIVQMITBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O4P/c1-7-5-6-10-13(9,11-7)12-8(2,3)4/h7H,5-6H2,1-4H3.
What are the key properties of 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide?
4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide has a molecular weight of 208.19 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphosphinane 2-oxide is sourced from PubChem (CID 102249140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).