C20H38O2 — CID 102249512
2,9-dimethyl-4,7-bis(2-methylpropyl)dec-5-yne-4,7-diol (PubChem CID 102249512) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 2,9-dimethyl-4,7-bis(2-methylpropyl)dec-5-yne-4,7-diol.
| Compound Name | 2,9-dimethyl-4,7-bis(2-methylpropyl)dec-5-yne-4,7-diol |
|---|---|
| PubChem CID | 102249512 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 2,9-dimethyl-4,7-bis(2-methylpropyl)dec-5-yne-4,7-diol |
| SMILES | CC(C)CC(O)(C#CC(O)(CC(C)C)CC(C)C)CC(C)C |
| InChI | InChI=1S/C20H38O2/c1-15(2)11-19(21,12-16(3)4)9-10-20(22,13-17(5)6)14-18(7)8/h15-18,21-22H,11-14H2,1-8H3 |
| InChIKey | YZMGLMHVHLJONY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|