C24H46O2 — CID 102249514
5,14-diethyl-8,11-dimethyloctadec-9-yne-8,11-diol (PubChem CID 102249514) has the molecular formula C24H46O2 and a molecular weight of 366.63 g/mol. Its IUPAC name is 5,14-diethyl-8,11-dimethyloctadec-9-yne-8,11-diol.
| Compound Name | 5,14-diethyl-8,11-dimethyloctadec-9-yne-8,11-diol |
|---|---|
| PubChem CID | 102249514 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | 5,14-diethyl-8,11-dimethyloctadec-9-yne-8,11-diol |
| SMILES | CCCCC(CC)CCC(C)(O)C#CC(C)(O)CCC(CC)CCCC |
| InChI | InChI=1S/C24H46O2/c1-7-11-13-21(9-3)15-17-23(5,25)19-20-24(6,26)18-16-22(10-4)14-12-8-2/h21-22,25-26H,7-18H2,1-6H3 |
| InChIKey | BCYKALJFXNPZIU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|