About (3R)-3-(trifluoromethyl)thiane 1-oxide
(3R)-3-(trifluoromethyl)thiane 1-oxide (PubChem CID 102249885) has the molecular formula C6H9F3OS
and a molecular weight of 186.20 g/mol. Its IUPAC name is (3R)-3-(trifluoromethyl)thiane 1-oxide.
Molecular Properties
| Compound Name | (3R)-3-(trifluoromethyl)thiane 1-oxide |
| PubChem CID | 102249885 |
| Molecular Formula | C6H9F3OS |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | (3R)-3-(trifluoromethyl)thiane 1-oxide |
| SMILES | O=S1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C6H9F3OS/c7-6(8,9)5-2-1-3-11(10)4-5/h5H,1-4H2/t5-,11?/m0/s1 |
| InChIKey | LPVVZUUNWWXAOI-ITZCMCNPSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-(trifluoromethyl)thiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(trifluoromethyl)thiane 1-oxide?
The IUPAC name of (3R)-3-(trifluoromethyl)thiane 1-oxide (CID 102249885) is (3R)-3-(trifluoromethyl)thiane 1-oxide.
What is the SMILES notation for (3R)-3-(trifluoromethyl)thiane 1-oxide?
The canonical SMILES for (3R)-3-(trifluoromethyl)thiane 1-oxide is O=S1CCC[C@H](C(F)(F)F)C1.
What is the InChIKey of (3R)-3-(trifluoromethyl)thiane 1-oxide?
The InChIKey is LPVVZUUNWWXAOI-ITZCMCNPSA-N. The full InChI is InChI=1S/C6H9F3OS/c7-6(8,9)5-2-1-3-11(10)4-5/h5H,1-4H2/t5-,11?/m0/s1.
What are the key properties of (3R)-3-(trifluoromethyl)thiane 1-oxide?
(3R)-3-(trifluoromethyl)thiane 1-oxide has a molecular weight of 186.20 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(trifluoromethyl)thiane 1-oxide is sourced from PubChem (CID 102249885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).