C7H14N2O2S — CID 102249973
N-(2,2-dimethoxyethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 102249973) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102249973 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | COC(CNC1=NCCS1)OC |
| InChI | InChI=1S/C7H14N2O2S/c1-10-6(11-2)5-9-7-8-3-4-12-7/h6H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | PUYWQYHOBXMQPK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|