C24H27F3O5 — CID 102250030
(4aR,6R,8aS)-2-(4-butoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 102250030) has the molecular formula C24H27F3O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is (4aR,6R,8aS)-2-(4-butoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,8aS)-2-(4-butoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 102250030 |
| Molecular Formula | C24H27F3O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (4aR,6R,8aS)-2-(4-butoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCOc1ccc(C2OC[C@H]3O[C@@H](c4ccc(OC(F)(F)F)cc4)CC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C24H27F3O5/c1-2-3-14-28-18-8-6-17(7-9-18)23-29-15-22-21(31-23)13-12-20(30-22)16-4-10-19(11-5-16)32-24(25,26)27/h4-11,20-23H,2-3,12-15H2,1H3/t20-,21+,22-,23?/m1/s1 |
| InChIKey | IBMGUOLFDMJAIS-VNYJYPEVSA-N |
| XLogP | 6.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|