C20H10 — CID 102250040
hexacyclo[9.7.1.12,10.04,17.06,15.08,13]icosa-1(19),2(20),3,5,7,9,11,13,15,17-decaene (PubChem CID 102250040) has the molecular formula C20H10 and a molecular weight of 250.30 g/mol. Its IUPAC name is hexacyclo[9.7.1.12,10.04,17.06,15.08,13]icosa-1(19),2(20),3,5,7,9,11,13,15,17-decaene.
| Compound Name | hexacyclo[9.7.1.12,10.04,17.06,15.08,13]icosa-1(19),2(20),3,5,7,9,11,13,15,17-decaene |
|---|---|
| PubChem CID | 102250040 |
| Molecular Formula | C20H10 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | hexacyclo[9.7.1.12,10.04,17.06,15.08,13]icosa-1(19),2(20),3,5,7,9,11,13,15,17-decaene |
| SMILES | c1c2cc3cc4cc5cc1c1cc2cc3cc4cc5c1 |
| InChI | InChI=1S/C20H10/c1-11-2-15-7-19-8-16-3-12(1)14-4-13(11)5-17(15)9-20(19)10-18(16)6-14/h1-10H |
| InChIKey | NFWCXZLFAJYZFU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|