About cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate
cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 102250134) has the molecular formula C18H24O3
and a molecular weight of 288.39 g/mol. Its IUPAC name is cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
| PubChem CID | 102250134 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CC(c2ccccc2)C[C@@]1(O)C(=O)OC(C)C |
| InChI | InChI=1S/C18H24O3/c1-12(2)16-10-15(14-8-6-5-7-9-14)11-18(16,20)17(19)21-13(3)4/h5-9,13,15-16,20H,1,10-11H2,2-4H3/t15?,16-,18-/m0/s1 |
| InChIKey | TUQCNJDTCMPEQX-YLGOGADGSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate?
The IUPAC name of cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate (CID 102250134) is cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate.
What is the SMILES notation for cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate?
The canonical SMILES for cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate is C=C(C)[C@@H]1CC(c2ccccc2)C[C@@]1(O)C(=O)OC(C)C.
What is the InChIKey of cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate?
The InChIKey is TUQCNJDTCMPEQX-YLGOGADGSA-N. The full InChI is InChI=1S/C18H24O3/c1-12(2)16-10-15(14-8-6-5-7-9-14)11-18(16,20)17(19)21-13(3)4/h5-9,13,15-16,20H,1,10-11H2,2-4H3/t15?,16-,18-/m0/s1.
What are the key properties of cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate?
cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate has a molecular weight of 288.39 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-propan-2-yl (1S,2S)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate is sourced from PubChem (CID 102250134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).