About [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane
[(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane (PubChem CID 102250275) has the molecular formula C26H58O2Si2
and a molecular weight of 458.92 g/mol. Its IUPAC name is [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane |
| PubChem CID | 102250275 |
| Molecular Formula | C26H58O2Si2 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.40 |
| IUPAC Name | [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCC[C@H](C)[C@@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H58O2Si2/c1-19(2)29(20(3)4,21(5)6)27-17-15-25(13)26(14)16-18-28-30(22(7)8,23(9)10)24(11)12/h19-26H,15-18H2,1-14H3/t25-,26-/m0/s1 |
| InChIKey | MSHKKMJFTSMQBF-UIOOFZCWSA-N |
| XLogP | 9.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane (CID 102250275) is [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane is CC(C)[Si](OCC[C@H](C)[C@@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane?
The InChIKey is MSHKKMJFTSMQBF-UIOOFZCWSA-N. The full InChI is InChI=1S/C26H58O2Si2/c1-19(2)29(20(3)4,21(5)6)27-17-15-25(13)26(14)16-18-28-30(22(7)8,23(9)10)24(11)12/h19-26H,15-18H2,1-14H3/t25-,26-/m0/s1.
What are the key properties of [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane?
[(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane has a molecular weight of 458.92 g/mol, XLogP of 9.42, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-3,4-dimethyl-6-tri(propan-2-yl)silyloxyhexoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 102250275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).