C28H42ClNO6Si — CID 102250864
diethyl (1R,3R,7R,9R)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-oxo-5-azabicyclo[7.1.0]decane-10,10-dicarboxylate (PubChem CID 102250864) has the molecular formula C28H42ClNO6Si and a molecular weight of 552.18 g/mol. Its IUPAC name is diethyl (1R,3R,7R,9R)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-oxo-5-azabicyclo[7.1.0]decane-10,10-dicarboxylate.
| Compound Name | diethyl (1R,3R,7R,9R)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-oxo-5-azabicyclo[7.1.0]decane-10,10-dicarboxylate |
|---|---|
| PubChem CID | 102250864 |
| Molecular Formula | C28H42ClNO6Si |
| Molecular Weight | 552.18 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | diethyl (1R,3R,7R,9R)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-chloro-4-oxo-5-azabicyclo[7.1.0]decane-10,10-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN(Cc3ccccc3)C(=O)[C@H](Cl)C[C@H]21 |
| InChI | InChI=1S/C28H42ClNO6Si/c1-8-34-25(32)28(26(33)35-9-2)21-15-20(36-37(6,7)27(3,4)5)18-30(17-19-13-11-10-12-14-19)24(31)23(29)16-22(21)28/h10-14,20-23H,8-9,15-18H2,1-7H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | OVNYBPROCAXQKC-SSGKUCQKSA-N |
| XLogP | 5.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.18 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|