C38H40N3O4P — CID 102251061
[(1S,17S,19R,24R)-25-benzoyl-9-(diethylamino)-8,10-dioxa-18,25-diaza-9-phosphapentacyclo[15.8.0.02,7.011,16.019,24]pentacosa-2,4,6,11,13,15-hexaen-18-yl]-phenylmethanone (PubChem CID 102251061) has the molecular formula C38H40N3O4P and a molecular weight of 633.73 g/mol. Its IUPAC name is [(1S,17S,19R,24R)-25-benzoyl-9-(diethylamino)-8,10-dioxa-18,25-diaza-9-phosphapentacyclo[15.8.0.02,7.011,16.019,24]pentacosa-2,4,6,11,13,15-hexaen-18-yl]-phenylmethanone.
| Compound Name | [(1S,17S,19R,24R)-25-benzoyl-9-(diethylamino)-8,10-dioxa-18,25-diaza-9-phosphapentacyclo[15.8.0.02,7.011,16.019,24]pentacosa-2,4,6,11,13,15-hexaen-18-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102251061 |
| Molecular Formula | C38H40N3O4P |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | [(1S,17S,19R,24R)-25-benzoyl-9-(diethylamino)-8,10-dioxa-18,25-diaza-9-phosphapentacyclo[15.8.0.02,7.011,16.019,24]pentacosa-2,4,6,11,13,15-hexaen-18-yl]-phenylmethanone |
| SMILES | CCN(CC)P1Oc2ccccc2[C@H]2[C@H](c3ccccc3O1)N(C(=O)c1ccccc1)[C@@H]1CCCC[C@H]1N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H40N3O4P/c1-3-39(4-2)46-44-33-25-15-11-21-29(33)35-36(30-22-12-16-26-34(30)45-46)41(38(43)28-19-9-6-10-20-28)32-24-14-13-23-31(32)40(35)37(42)27-17-7-5-8-18-27/h5-12,15-22,25-26,31-32,35-36H,3-4,13-14,23-24H2,1-2H3/t31-,32-,35+,36+/m1/s1 |
| InChIKey | VHKSDJTXOHYRLB-VPZGHRDASA-N |
| XLogP | 8.42 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|