About methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate
methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate (PubChem CID 10225108) has the molecular formula C23H19FN2O6
and a molecular weight of 438.41 g/mol. Its IUPAC name is methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate |
| PubChem CID | 10225108 |
| Molecular Formula | C23H19FN2O6 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate |
| SMILES | COC(=O)Cc1ccc(CNC(=O)c2cccnc2Oc2ccc3c(c2)OCO3)c(F)c1 |
| InChI | InChI=1S/C23H19FN2O6/c1-29-21(27)10-14-4-5-15(18(24)9-14)12-26-22(28)17-3-2-8-25-23(17)32-16-6-7-19-20(11-16)31-13-30-19/h2-9,11H,10,12-13H2,1H3,(H,26,28) |
| InChIKey | NCNVYXZLTHAQEF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate?
The IUPAC name of methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate (CID 10225108) is methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate.
What is the SMILES notation for methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate?
The canonical SMILES for methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate is COC(=O)Cc1ccc(CNC(=O)c2cccnc2Oc2ccc3c(c2)OCO3)c(F)c1.
What is the InChIKey of methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate?
The InChIKey is NCNVYXZLTHAQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FN2O6/c1-29-21(27)10-14-4-5-15(18(24)9-14)12-26-22(28)17-3-2-8-25-23(17)32-16-6-7-19-20(11-16)31-13-30-19/h2-9,11H,10,12-13H2,1H3,(H,26,28).
What are the key properties of methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate?
methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate has a molecular weight of 438.41 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[[[2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbonyl]amino]methyl]-3-fluorophenyl]acetate is sourced from PubChem (CID 10225108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).