C44H46Br2N4O2S3 — CID 102251374
4,9-bis(5-bromothiophen-2-yl)-6,7-bis[4-(2-ethylhexoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 102251374) has the molecular formula C44H46Br2N4O2S3 and a molecular weight of 918.89 g/mol. Its IUPAC name is 4,9-bis(5-bromothiophen-2-yl)-6,7-bis[4-(2-ethylhexoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis(5-bromothiophen-2-yl)-6,7-bis[4-(2-ethylhexoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 102251374 |
| Molecular Formula | C44H46Br2N4O2S3 |
| Molecular Weight | 918.89 g/mol |
| Exact Mass | 916.11 |
| IUPAC Name | 4,9-bis(5-bromothiophen-2-yl)-6,7-bis[4-(2-ethylhexoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCC(CC)COc1ccc(-c2nc3c(-c4ccc(Br)s4)c4nsnc4c(-c4ccc(Br)s4)c3nc2-c2ccc(OCC(CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C44H46Br2N4O2S3/c1-5-9-11-27(7-3)25-51-31-17-13-29(14-18-31)39-40(30-15-19-32(20-16-30)52-26-28(8-4)12-10-6-2)48-42-38(34-22-24-36(46)54-34)44-43(49-55-50-44)37(41(42)47-39)33-21-23-35(45)53-33/h13-24,27-28H,5-12,25-26H2,1-4H3 |
| InChIKey | QSXHHWAGXVQXNB-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.89 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |