C32H47NO5Si — CID 102251471
tert-butyl-[[(1S,2S,3S,8S,9S)-11,11-dimethyl-3-[(2-methylpropan-2-yl)oxy]-7,10,12-trioxa-6-azatricyclo[6.5.0.02,6]tridecan-9-yl]methoxy]-diphenylsilane (PubChem CID 102251471) has the molecular formula C32H47NO5Si and a molecular weight of 553.82 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,3S,8S,9S)-11,11-dimethyl-3-[(2-methylpropan-2-yl)oxy]-7,10,12-trioxa-6-azatricyclo[6.5.0.02,6]tridecan-9-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1S,2S,3S,8S,9S)-11,11-dimethyl-3-[(2-methylpropan-2-yl)oxy]-7,10,12-trioxa-6-azatricyclo[6.5.0.02,6]tridecan-9-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102251471 |
| Molecular Formula | C32H47NO5Si |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | tert-butyl-[[(1S,2S,3S,8S,9S)-11,11-dimethyl-3-[(2-methylpropan-2-yl)oxy]-7,10,12-trioxa-6-azatricyclo[6.5.0.02,6]tridecan-9-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)O[C@H]1CCN2O[C@H]3[C@H](COC(C)(C)O[C@H]3CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C32H47NO5Si/c1-30(2,3)36-26-19-20-33-28(26)25-21-34-32(7,8)37-27(29(25)38-33)22-35-39(31(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,25-29H,19-22H2,1-8H3/t25-,26+,27+,28+,29+/m1/s1 |
| InChIKey | YWFFTXMEKJCMNO-QZLCNWOESA-N |
| XLogP | 4.90 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|