C27H43NO8 — CID 102251597
[(3R,4R,5S,6S)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2S)-2-ethyl-4-oxo-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 102251597) has the molecular formula C27H43NO8 and a molecular weight of 509.64 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2S)-2-ethyl-4-oxo-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4R,5S,6S)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2S)-2-ethyl-4-oxo-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102251597 |
| Molecular Formula | C27H43NO8 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | [(3R,4R,5S,6S)-4,5-bis(2,2-dimethylpropanoyloxy)-6-[(2S)-2-ethyl-4-oxo-2,3-dihydropyridin-1-yl]oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H]1CC(=O)C=CN1[C@H]1OC[C@@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H43NO8/c1-11-16-14-17(29)12-13-28(16)21-20(36-24(32)27(8,9)10)19(35-23(31)26(5,6)7)18(15-33-21)34-22(30)25(2,3)4/h12-13,16,18-21H,11,14-15H2,1-10H3/t16-,18+,19+,20-,21-/m0/s1 |
| InChIKey | ONCIKNDOFRHNLU-MYGYKHERSA-N |
| XLogP | 3.78 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|