C22H29NO3 — CID 102251917
methyl (2S)-2-[(S)-(4-methoxyphenyl)-[[(1R)-1-phenylethyl]amino]methyl]-3-methylbutanoate (PubChem CID 102251917) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is methyl (2S)-2-[(S)-(4-methoxyphenyl)-[[(1R)-1-phenylethyl]amino]methyl]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(S)-(4-methoxyphenyl)-[[(1R)-1-phenylethyl]amino]methyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 102251917 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | methyl (2S)-2-[(S)-(4-methoxyphenyl)-[[(1R)-1-phenylethyl]amino]methyl]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](C(C)C)[C@H](N[C@H](C)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-15(2)20(22(24)26-5)21(18-11-13-19(25-4)14-12-18)23-16(3)17-9-7-6-8-10-17/h6-16,20-21,23H,1-5H3/t16-,20+,21-/m1/s1 |
| InChIKey | JTLGZWMHBLGCCE-TYCQWZJGSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |