C32H42O7Se — CID 102251947
[(2S)-pent-4-en-2-yl] 2-[4-[(2S,3S)-3-ethenyloxiran-2-yl]-1-phenylselanylbutyl]-4,6-bis(ethoxymethoxy)benzoate (PubChem CID 102251947) has the molecular formula C32H42O7Se and a molecular weight of 617.64 g/mol. Its IUPAC name is [(2S)-pent-4-en-2-yl] 2-[4-[(2S,3S)-3-ethenyloxiran-2-yl]-1-phenylselanylbutyl]-4,6-bis(ethoxymethoxy)benzoate.
| Compound Name | [(2S)-pent-4-en-2-yl] 2-[4-[(2S,3S)-3-ethenyloxiran-2-yl]-1-phenylselanylbutyl]-4,6-bis(ethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 102251947 |
| Molecular Formula | C32H42O7Se |
| Molecular Weight | 617.64 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | [(2S)-pent-4-en-2-yl] 2-[4-[(2S,3S)-3-ethenyloxiran-2-yl]-1-phenylselanylbutyl]-4,6-bis(ethoxymethoxy)benzoate |
| SMILES | C=CC[C@H](C)OC(=O)c1c(OCOCC)cc(OCOCC)cc1C(CCC[C@@H]1O[C@H]1C=C)[Se]c1ccccc1 |
| InChI | InChI=1S/C32H42O7Se/c1-6-14-23(5)38-32(33)31-26(19-24(36-21-34-8-3)20-29(31)37-22-35-9-4)30(40-25-15-11-10-12-16-25)18-13-17-28-27(7-2)39-28/h6-7,10-12,15-16,19-20,23,27-28,30H,1-2,8-9,13-14,17-18,21-22H2,3-5H3/t23-,27-,28-,30?/m0/s1 |
| InChIKey | WOJXXMNXHXSPHM-BQXCCFKVSA-N |
| XLogP | 5.75 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|