C24H34O8 — CID 102251949
(4S,6S,7Z,9S,12E)-16,18-bis(ethoxymethoxy)-6,9-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),7,12,15,17-pentaen-2-one (PubChem CID 102251949) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is (4S,6S,7Z,9S,12E)-16,18-bis(ethoxymethoxy)-6,9-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),7,12,15,17-pentaen-2-one.
| Compound Name | (4S,6S,7Z,9S,12E)-16,18-bis(ethoxymethoxy)-6,9-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),7,12,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 102251949 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (4S,6S,7Z,9S,12E)-16,18-bis(ethoxymethoxy)-6,9-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),7,12,15,17-pentaen-2-one |
| SMILES | CCOCOc1cc2c(c(OCOCC)c1)C(=O)O[C@@H](C)C[C@H](O)/C=C\[C@@H](O)CC/C=C/2 |
| InChI | InChI=1S/C24H34O8/c1-4-28-15-30-21-13-18-8-6-7-9-19(25)10-11-20(26)12-17(3)32-24(27)23(18)22(14-21)31-16-29-5-2/h6,8,10-11,13-14,17,19-20,25-26H,4-5,7,9,12,15-16H2,1-3H3/b8-6+,11-10-/t17-,19-,20+/m0/s1 |
| InChIKey | YBXBFCNCMJQTBL-BXZBVINWSA-N |
| XLogP | 3.45 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|