C19H32O2Si — CID 102251989
(3aS,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-5-one (PubChem CID 102251989) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (3aS,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-5-one.
| Compound Name | (3aS,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-5-one |
|---|---|
| PubChem CID | 102251989 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (3aS,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-5-one |
| SMILES | CC(C)=C1C=C(O[Si](C)(C)C(C)(C)C)[C@H]2CCC[C@H]2CC1=O |
| InChI | InChI=1S/C19H32O2Si/c1-13(2)16-12-18(21-22(6,7)19(3,4)5)15-10-8-9-14(15)11-17(16)20/h12,14-15H,8-11H2,1-7H3/t14-,15-/m0/s1 |
| InChIKey | GYACFERKJRCMRU-GJZGRUSLSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|