C12H14O — CID 102252022
[(1R,2R)-2-methyl-3-methylidene-1-phenylcyclopropyl]methanol (PubChem CID 102252022) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is [(1R,2R)-2-methyl-3-methylidene-1-phenylcyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-methyl-3-methylidene-1-phenylcyclopropyl]methanol |
|---|---|
| PubChem CID | 102252022 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | [(1R,2R)-2-methyl-3-methylidene-1-phenylcyclopropyl]methanol |
| SMILES | C=C1[C@@H](C)[C@]1(CO)c1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-9-10(2)12(9,8-13)11-6-4-3-5-7-11/h3-7,10,13H,1,8H2,2H3/t10-,12-/m1/s1 |
| InChIKey | OQHUZMJCAATZIL-ZYHUDNBSSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|