C49H67N3O6P2 — CID 102252258
2-[1,3-bis[(2-diphenylphosphorylacetyl)amino]propan-2-yloxy]-N,N-bis(2-ethylhexyl)acetamide (PubChem CID 102252258) has the molecular formula C49H67N3O6P2 and a molecular weight of 856.04 g/mol. Its IUPAC name is 2-[1,3-bis[(2-diphenylphosphorylacetyl)amino]propan-2-yloxy]-N,N-bis(2-ethylhexyl)acetamide.
| Compound Name | 2-[1,3-bis[(2-diphenylphosphorylacetyl)amino]propan-2-yloxy]-N,N-bis(2-ethylhexyl)acetamide |
|---|---|
| PubChem CID | 102252258 |
| Molecular Formula | C49H67N3O6P2 |
| Molecular Weight | 856.04 g/mol |
| Exact Mass | 855.45 |
| IUPAC Name | 2-[1,3-bis[(2-diphenylphosphorylacetyl)amino]propan-2-yloxy]-N,N-bis(2-ethylhexyl)acetamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)COC(CNC(=O)CP(=O)(c1ccccc1)c1ccccc1)CNC(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H67N3O6P2/c1-5-9-23-40(7-3)35-52(36-41(8-4)24-10-6-2)49(55)37-58-42(33-50-47(53)38-59(56,43-25-15-11-16-26-43)44-27-17-12-18-28-44)34-51-48(54)39-60(57,45-29-19-13-20-30-45)46-31-21-14-22-32-46/h11-22,25-32,40-42H,5-10,23-24,33-39H2,1-4H3,(H,50,53)(H,51,54) |
| InChIKey | ZGXGDIRYUXCJGU-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.04 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|