C23H22O3S — CID 102252348
(1R,2S)-2-(benzenesulfonylmethyl)-1,2-diphenylbut-3-en-1-ol (PubChem CID 102252348) has the molecular formula C23H22O3S and a molecular weight of 378.49 g/mol. Its IUPAC name is (1R,2S)-2-(benzenesulfonylmethyl)-1,2-diphenylbut-3-en-1-ol.
| Compound Name | (1R,2S)-2-(benzenesulfonylmethyl)-1,2-diphenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 102252348 |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (1R,2S)-2-(benzenesulfonylmethyl)-1,2-diphenylbut-3-en-1-ol |
| SMILES | C=C[C@](CS(=O)(=O)c1ccccc1)(c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H22O3S/c1-2-23(20-14-8-4-9-15-20,22(24)19-12-6-3-7-13-19)18-27(25,26)21-16-10-5-11-17-21/h2-17,22,24H,1,18H2/t22-,23+/m1/s1 |
| InChIKey | KQNBFUKBPIASKP-PKTZIBPZSA-N |
| XLogP | 4.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|