C22H15F3N4O3 — CID 10225246
4-(8-benzoyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 10225246) has the molecular formula C22H15F3N4O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is 4-(8-benzoyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(8-benzoyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 10225246 |
| Molecular Formula | C22H15F3N4O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 4-(8-benzoyl-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C3C4CC(CN4C(=O)c4ccccc4)N3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C22H15F3N4O3/c23-22(24,25)16-8-14(7-6-13(16)10-26)29-20(31)18-17-9-15(28(18)21(29)32)11-27(17)19(30)12-4-2-1-3-5-12/h1-8,15,17-18H,9,11H2 |
| InChIKey | VCKCSTNIXSJIQO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|