C14H30OSi — CID 102252704
[(Z,5R,6S)-6-methoxy-2,2,5-trimethylhept-3-en-4-yl]-trimethylsilane (PubChem CID 102252704) has the molecular formula C14H30OSi and a molecular weight of 242.48 g/mol. Its IUPAC name is [(Z,5R,6S)-6-methoxy-2,2,5-trimethylhept-3-en-4-yl]-trimethylsilane.
| Compound Name | [(Z,5R,6S)-6-methoxy-2,2,5-trimethylhept-3-en-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102252704 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | [(Z,5R,6S)-6-methoxy-2,2,5-trimethylhept-3-en-4-yl]-trimethylsilane |
| SMILES | CO[C@@H](C)[C@@H](C)/C(=C/C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi/c1-11(12(2)15-6)13(16(7,8)9)10-14(3,4)5/h10-12H,1-9H3/b13-10-/t11-,12+/m1/s1 |
| InChIKey | NJILCFXZPPXMTM-SZKSSMSYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|