About 2,6-bis(ethenyl)-9,10-dihydroanthracene
2,6-bis(ethenyl)-9,10-dihydroanthracene (PubChem CID 102252812) has the molecular formula C18H16
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2,6-bis(ethenyl)-9,10-dihydroanthracene.
Molecular Properties
| Compound Name | 2,6-bis(ethenyl)-9,10-dihydroanthracene |
| PubChem CID | 102252812 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2,6-bis(ethenyl)-9,10-dihydroanthracene |
| SMILES | C=Cc1ccc2c(c1)Cc1ccc(C=C)cc1C2 |
| InChI | InChI=1S/C18H16/c1-3-13-5-7-15-12-18-10-14(4-2)6-8-16(18)11-17(15)9-13/h3-10H,1-2,11-12H2 |
| InChIKey | DFDPJGKYRPGVKW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,6-bis(ethenyl)-9,10-dihydroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(ethenyl)-9,10-dihydroanthracene?
The IUPAC name of 2,6-bis(ethenyl)-9,10-dihydroanthracene (CID 102252812) is 2,6-bis(ethenyl)-9,10-dihydroanthracene.
What is the SMILES notation for 2,6-bis(ethenyl)-9,10-dihydroanthracene?
The canonical SMILES for 2,6-bis(ethenyl)-9,10-dihydroanthracene is C=Cc1ccc2c(c1)Cc1ccc(C=C)cc1C2.
What is the InChIKey of 2,6-bis(ethenyl)-9,10-dihydroanthracene?
The InChIKey is DFDPJGKYRPGVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16/c1-3-13-5-7-15-12-18-10-14(4-2)6-8-16(18)11-17(15)9-13/h3-10H,1-2,11-12H2.
What are the key properties of 2,6-bis(ethenyl)-9,10-dihydroanthracene?
2,6-bis(ethenyl)-9,10-dihydroanthracene has a molecular weight of 232.33 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(ethenyl)-9,10-dihydroanthracene is sourced from PubChem (CID 102252812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).