C20H28O2 — CID 102252878
4a,8a-dimethyl-6-(2-methylprop-1-enoxy)-3,4,4b,5,6,9-hexahydro-1H-phenanthren-2-one (PubChem CID 102252878) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 4a,8a-dimethyl-6-(2-methylprop-1-enoxy)-3,4,4b,5,6,9-hexahydro-1H-phenanthren-2-one.
| Compound Name | 4a,8a-dimethyl-6-(2-methylprop-1-enoxy)-3,4,4b,5,6,9-hexahydro-1H-phenanthren-2-one |
|---|---|
| PubChem CID | 102252878 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 4a,8a-dimethyl-6-(2-methylprop-1-enoxy)-3,4,4b,5,6,9-hexahydro-1H-phenanthren-2-one |
| SMILES | CC(C)=COC1C=CC2(C)CC=C3CC(=O)CCC3(C)C2C1 |
| InChI | InChI=1S/C20H28O2/c1-14(2)13-22-17-7-9-19(3)8-5-15-11-16(21)6-10-20(15,4)18(19)12-17/h5,7,9,13,17-18H,6,8,10-12H2,1-4H3 |
| InChIKey | BBZUEEAJDFHYSJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|