C20H21N3O4 — CID 102252977
4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylpyrimidine-5-carbonitrile (PubChem CID 102252977) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylpyrimidine-5-carbonitrile.
| Compound Name | 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 102252977 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylpyrimidine-5-carbonitrile |
| SMILES | Cc1ncc(C#N)c([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)n1 |
| InChI | InChI=1S/C20H21N3O4/c1-12-22-10-14(9-21)15(23-12)16-17(24-11-13-7-5-4-6-8-13)18-19(25-16)27-20(2,3)26-18/h4-8,10,16-19H,11H2,1-3H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | FZEFBNHXGLBJFI-FCGDIQPGSA-N |
| XLogP | 2.79 |
| TPSA | 86.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |