About (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol
(1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol (PubChem CID 102253246) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol.
Molecular Properties
| Compound Name | (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol |
| PubChem CID | 102253246 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol |
| SMILES | O[C@@H](C1=CC=C1)[C@@H](O)C1=CC=C1 |
| InChI | InChI=1S/C10H10O2/c11-9(7-3-1-4-7)10(12)8-5-2-6-8/h1-6,9-12H/t9-,10-/m0/s1 |
| InChIKey | GRMKTKOFQCPBPE-UWVGGRQHSA-N |
| XLogP | 0.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol?
The IUPAC name of (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol (CID 102253246) is (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol.
What is the SMILES notation for (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol?
The canonical SMILES for (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol is O[C@@H](C1=CC=C1)[C@@H](O)C1=CC=C1.
What is the InChIKey of (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol?
The InChIKey is GRMKTKOFQCPBPE-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H10O2/c11-9(7-3-1-4-7)10(12)8-5-2-6-8/h1-6,9-12H/t9-,10-/m0/s1.
What are the key properties of (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol?
(1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol has a molecular weight of 162.19 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1,2-di(cyclobutadienyl)ethane-1,2-diol is sourced from PubChem (CID 102253246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).