C22H37NO4Si2 — CID 102253825
methyl (1'S,2'S,6'R,7'R)-5,5-dimethyl-7',9'-bis(trimethylsilyl)spiro[1,3-dioxane-2,10'-3-azatricyclo[5.2.1.02,6]deca-3,8-diene]-1'-carboxylate (PubChem CID 102253825) has the molecular formula C22H37NO4Si2 and a molecular weight of 435.71 g/mol. Its IUPAC name is methyl (1'S,2'S,6'R,7'R)-5,5-dimethyl-7',9'-bis(trimethylsilyl)spiro[1,3-dioxane-2,10'-3-azatricyclo[5.2.1.02,6]deca-3,8-diene]-1'-carboxylate.
| Compound Name | methyl (1'S,2'S,6'R,7'R)-5,5-dimethyl-7',9'-bis(trimethylsilyl)spiro[1,3-dioxane-2,10'-3-azatricyclo[5.2.1.02,6]deca-3,8-diene]-1'-carboxylate |
|---|---|
| PubChem CID | 102253825 |
| Molecular Formula | C22H37NO4Si2 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | methyl (1'S,2'S,6'R,7'R)-5,5-dimethyl-7',9'-bis(trimethylsilyl)spiro[1,3-dioxane-2,10'-3-azatricyclo[5.2.1.02,6]deca-3,8-diene]-1'-carboxylate |
| SMILES | COC(=O)[C@]12C([Si](C)(C)C)=C[C@]([Si](C)(C)C)([C@@H]3CC=N[C@@H]31)C21OCC(C)(C)CO1 |
| InChI | InChI=1S/C22H37NO4Si2/c1-19(2)13-26-22(27-14-19)20(29(7,8)9)12-16(28(4,5)6)21(22,18(24)25-3)17-15(20)10-11-23-17/h11-12,15,17H,10,13-14H2,1-9H3/t15-,17+,20+,21+/m1/s1 |
| InChIKey | PVHGBTJJACGGOQ-GWKIZSTFSA-N |
| XLogP | 4.28 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|