About 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one
5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one (PubChem CID 102253959) has the molecular formula C7H10O3S
and a molecular weight of 174.22 g/mol. Its IUPAC name is 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one.
Molecular Properties
| Compound Name | 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one |
| PubChem CID | 102253959 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one |
| SMILES | C=CCOCC1CSC(=O)O1 |
| InChI | InChI=1S/C7H10O3S/c1-2-3-9-4-6-5-11-7(8)10-6/h2,6H,1,3-5H2 |
| InChIKey | PYHIEQXLBKQGNS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one?
The IUPAC name of 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one (CID 102253959) is 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one.
What is the SMILES notation for 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one?
The canonical SMILES for 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one is C=CCOCC1CSC(=O)O1.
What is the InChIKey of 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one?
The InChIKey is PYHIEQXLBKQGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S/c1-2-3-9-4-6-5-11-7(8)10-6/h2,6H,1,3-5H2.
What are the key properties of 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one?
5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one has a molecular weight of 174.22 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(prop-2-enoxymethyl)-1,3-oxathiolan-2-one is sourced from PubChem (CID 102253959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).