About CID 102254263
CID 102254263 (PubChem CID 102254263) has the molecular formula C11H15N3O4+
and a molecular weight of 253.26 g/mol.
Molecular Properties
| Compound Name | CID 102254263 |
| PubChem CID | 102254263 |
| Molecular Formula | C11H15N3O4+ |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | — |
| SMILES | CCC(=[O+])ONCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15N3O4/c1-2-11(15)18-13-8-7-12-9-3-5-10(6-4-9)14(16)17/h3-6,12-13H,2,7-8H2,1H3/q+1 |
| InChIKey | LQBZKHARGDBFOE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102254263 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102254263?
The IUPAC name of CID 102254263 (CID 102254263) is not available.
What is the SMILES notation for CID 102254263?
The canonical SMILES for CID 102254263 is CCC(=[O+])ONCCNc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of CID 102254263?
The InChIKey is LQBZKHARGDBFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O4/c1-2-11(15)18-13-8-7-12-9-3-5-10(6-4-9)14(16)17/h3-6,12-13H,2,7-8H2,1H3/q+1.
What are the key properties of CID 102254263?
CID 102254263 has a molecular weight of 253.26 g/mol, XLogP of 1.46, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102254263 is sourced from PubChem (CID 102254263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).