C22H26N4O4 — CID 102254293
2,6-bis[(1R,2R)-2-aminocyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 102254293) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2,6-bis[(1R,2R)-2-aminocyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[(1R,2R)-2-aminocyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 102254293 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2,6-bis[(1R,2R)-2-aminocyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | N[C@@H]1CCCC[C@H]1n1c(=O)c2cc3c(=O)n([C@@H]4CCCC[C@H]4N)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C22H26N4O4/c23-15-5-1-3-7-17(15)25-19(27)11-9-13-14(10-12(11)20(25)28)22(30)26(21(13)29)18-8-4-2-6-16(18)24/h9-10,15-18H,1-8,23-24H2/t15-,16-,17-,18-/m1/s1 |
| InChIKey | MYGVTAFPYZXZMJ-BRSBDYLESA-N |
| XLogP | 0.80 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |