C17H11N5O2 — CID 102254421
7-imino-3-methyl-10,12-dioxo-11-phenyl-3,6,11-triazatricyclo[7.3.0.02,6]dodeca-1,4,8-triene-8-carbonitrile (PubChem CID 102254421) has the molecular formula C17H11N5O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 7-imino-3-methyl-10,12-dioxo-11-phenyl-3,6,11-triazatricyclo[7.3.0.02,6]dodeca-1,4,8-triene-8-carbonitrile.
| Compound Name | 7-imino-3-methyl-10,12-dioxo-11-phenyl-3,6,11-triazatricyclo[7.3.0.02,6]dodeca-1,4,8-triene-8-carbonitrile |
|---|---|
| PubChem CID | 102254421 |
| Molecular Formula | C17H11N5O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 7-imino-3-methyl-10,12-dioxo-11-phenyl-3,6,11-triazatricyclo[7.3.0.02,6]dodeca-1,4,8-triene-8-carbonitrile |
| SMILES | [H]/N=c1/c(C#N)c2c(c3n(C)ccn13)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C17H11N5O2/c1-20-7-8-21-14(19)11(9-18)12-13(15(20)21)17(24)22(16(12)23)10-5-3-2-4-6-10/h2-8,19H,1H3/b19-14- |
| InChIKey | AWFLPYVSPRQXNH-RGEXLXHISA-N |
| XLogP | 1.43 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|