C19H36O2Si — CID 102254535
trimethyl-[1-[(2R,3S)-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]ethenyl]silane (PubChem CID 102254535) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is trimethyl-[1-[(2R,3S)-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]ethenyl]silane.
| Compound Name | trimethyl-[1-[(2R,3S)-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]ethenyl]silane |
|---|---|
| PubChem CID | 102254535 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | trimethyl-[1-[(2R,3S)-2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyoxolan-3-yl]ethenyl]silane |
| SMILES | C=C([C@H]1CCO[C@@H]1O[C@H]1C[C@H](C)CC[C@@H]1C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-13(2)16-9-8-14(3)12-18(16)21-19-17(10-11-20-19)15(4)22(5,6)7/h13-14,16-19H,4,8-12H2,1-3,5-7H3/t14-,16-,17-,18+,19-/m1/s1 |
| InChIKey | OJDHNGLNLGOOHZ-RXABAKJHSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|