About CID 102254581
CID 102254581 (PubChem CID 102254581) has the molecular formula C45H72O2P2
and a molecular weight of 707.02 g/mol.
Molecular Properties
| Compound Name | CID 102254581 |
| PubChem CID | 102254581 |
| Molecular Formula | C45H72O2P2 |
| Molecular Weight | 707.02 g/mol |
| Exact Mass | 706.50 |
| IUPAC Name | — |
| SMILES | COC(=O)CP1=C(c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)P(C(C)(C)C)C=1c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C45H72O2P2/c1-39(2,3)28-23-30(41(7,8)9)35(31(24-28)42(10,11)12)37-48(27-34(46)47-22)38(49(37)45(19,20)21)36-32(43(13,14)15)25-29(40(4,5)6)26-33(36)44(16,17)18/h23-26H,27H2,1-22H3 |
| InChIKey | RIKCXXNMQJKWBL-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 707.02 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102254581 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102254581?
The IUPAC name of CID 102254581 (CID 102254581) is not available.
What is the SMILES notation for CID 102254581?
The canonical SMILES for CID 102254581 is COC(=O)CP1=C(c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)P(C(C)(C)C)C=1c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of CID 102254581?
The InChIKey is RIKCXXNMQJKWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H72O2P2/c1-39(2,3)28-23-30(41(7,8)9)35(31(24-28)42(10,11)12)37-48(27-34(46)47-22)38(49(37)45(19,20)21)36-32(43(13,14)15)25-29(40(4,5)6)26-33(36)44(16,17)18/h23-26H,27H2,1-22H3.
What are the key properties of CID 102254581?
CID 102254581 has a molecular weight of 707.02 g/mol, XLogP of 13.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102254581 is sourced from PubChem (CID 102254581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).