C60H72P2S2 — CID 102254650
[2,3-bis(5-phenylthiophen-2-yl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 102254650) has the molecular formula C60H72P2S2 and a molecular weight of 919.32 g/mol. Its IUPAC name is [2,3-bis(5-phenylthiophen-2-yl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [2,3-bis(5-phenylthiophen-2-yl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 102254650 |
| Molecular Formula | C60H72P2S2 |
| Molecular Weight | 919.32 g/mol |
| Exact Mass | 918.46 |
| IUPAC Name | [2,3-bis(5-phenylthiophen-2-yl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=c2\c(-c3ccc(-c4ccccc4)s3)c(-c3ccc(-c4ccccc4)s3)\c2=P/c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H72P2S2/c1-55(2,3)39-33-41(57(7,8)9)51(42(34-39)58(10,11)12)61-53-49(47-31-29-45(63-47)37-25-21-19-22-26-37)50(48-32-30-46(64-48)38-27-23-20-24-28-38)54(53)62-52-43(59(13,14)15)35-40(56(4,5)6)36-44(52)60(16,17)18/h19-36H,1-18H3 |
| InChIKey | BEKZBIWDFPOQKE-UHFFFAOYSA-N |
| XLogP | 18.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.32 |
| LogP ≤ 5 | 18.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|