About 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene
7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 102254788) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene.
Molecular Properties
| Compound Name | 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene |
| PubChem CID | 102254788 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | C/C=C\C1=CC2(CCC1)OCCO2 |
| InChI | InChI=1S/C11H16O2/c1-2-4-10-5-3-6-11(9-10)12-7-8-13-11/h2,4,9H,3,5-8H2,1H3/b4-2- |
| InChIKey | SLWCYMGJIVFRDE-RQOWECAXSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene?
The IUPAC name of 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene (CID 102254788) is 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene.
What is the SMILES notation for 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene?
The canonical SMILES for 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene is C/C=C\C1=CC2(CCC1)OCCO2.
What is the InChIKey of 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene?
The InChIKey is SLWCYMGJIVFRDE-RQOWECAXSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-4-10-5-3-6-11(9-10)12-7-8-13-11/h2,4,9H,3,5-8H2,1H3/b4-2-.
What are the key properties of 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene?
7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene has a molecular weight of 180.25 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(Z)-prop-1-enyl]-1,4-dioxaspiro[4.5]dec-6-ene is sourced from PubChem (CID 102254788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).