C16H29BrO2Si — CID 102255139
(3S,5Z)-1-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnona-5,8-dien-2-one (PubChem CID 102255139) has the molecular formula C16H29BrO2Si and a molecular weight of 361.40 g/mol. Its IUPAC name is (3S,5Z)-1-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnona-5,8-dien-2-one.
| Compound Name | (3S,5Z)-1-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnona-5,8-dien-2-one |
|---|---|
| PubChem CID | 102255139 |
| Molecular Formula | C16H29BrO2Si |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (3S,5Z)-1-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-methylnona-5,8-dien-2-one |
| SMILES | C=CC/C(C)=C\C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)CBr |
| InChI | InChI=1S/C16H29BrO2Si/c1-8-9-13(2)10-11-15(14(18)12-17)19-20(6,7)16(3,4)5/h8,10,15H,1,9,11-12H2,2-7H3/b13-10-/t15-/m0/s1 |
| InChIKey | QZWFGHCQLOGATG-WVUXNXBLSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|