C40H46O6 — CID 102255474
4-[(E)-2-[4-[(E)-2-(4-carboxyphenyl)ethenyl]-2,5-bis(oct-7-enoxy)phenyl]ethenyl]benzoic acid (PubChem CID 102255474) has the molecular formula C40H46O6 and a molecular weight of 622.80 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(4-carboxyphenyl)ethenyl]-2,5-bis(oct-7-enoxy)phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[4-[(E)-2-(4-carboxyphenyl)ethenyl]-2,5-bis(oct-7-enoxy)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 102255474 |
| Molecular Formula | C40H46O6 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(4-carboxyphenyl)ethenyl]-2,5-bis(oct-7-enoxy)phenyl]ethenyl]benzoic acid |
| SMILES | C=CCCCCCCOc1cc(/C=C/c2ccc(C(=O)O)cc2)c(OCCCCCCC=C)cc1/C=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C40H46O6/c1-3-5-7-9-11-13-27-45-37-29-36(26-20-32-17-23-34(24-18-32)40(43)44)38(46-28-14-12-10-8-6-4-2)30-35(37)25-19-31-15-21-33(22-16-31)39(41)42/h3-4,15-26,29-30H,1-2,5-14,27-28H2,(H,41,42)(H,43,44)/b25-19+,26-20+ |
| InChIKey | KUMOGSZRPMZQJU-FQHZWJPGSA-N |
| XLogP | 10.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|