C24H19F3O4S — CID 102255565
1-[2-(methoxymethoxy)naphthalen-1-yl]-2-(trifluoromethylsulfonylmethyl)naphthalene (PubChem CID 102255565) has the molecular formula C24H19F3O4S and a molecular weight of 460.47 g/mol. Its IUPAC name is 1-[2-(methoxymethoxy)naphthalen-1-yl]-2-(trifluoromethylsulfonylmethyl)naphthalene.
| Compound Name | 1-[2-(methoxymethoxy)naphthalen-1-yl]-2-(trifluoromethylsulfonylmethyl)naphthalene |
|---|---|
| PubChem CID | 102255565 |
| Molecular Formula | C24H19F3O4S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-[2-(methoxymethoxy)naphthalen-1-yl]-2-(trifluoromethylsulfonylmethyl)naphthalene |
| SMILES | COCOc1ccc2ccccc2c1-c1c(CS(=O)(=O)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C24H19F3O4S/c1-30-15-31-21-13-12-17-7-3-5-9-20(17)23(21)22-18(14-32(28,29)24(25,26)27)11-10-16-6-2-4-8-19(16)22/h2-13H,14-15H2,1H3 |
| InChIKey | HGUOBXFMZMZGCH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|