C27H32O8 — CID 102255912
(1S,2S)-6,8-bis(methoxymethoxy)-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione (PubChem CID 102255912) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is (1S,2S)-6,8-bis(methoxymethoxy)-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione.
| Compound Name | (1S,2S)-6,8-bis(methoxymethoxy)-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 102255912 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (1S,2S)-6,8-bis(methoxymethoxy)-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione |
| SMILES | COCOc1cc(OCOC)c2c(c1)O[C@]13C(=CC4C[C@H]1C(C)(C)OC3(CC=C(C)C)C4=O)C2=O |
| InChI | InChI=1S/C27H32O8/c1-15(2)7-8-26-24(29)16-9-18-23(28)22-19(33-14-31-6)11-17(32-13-30-5)12-20(22)34-27(18,26)21(10-16)25(3,4)35-26/h7,9,11-12,16,21H,8,10,13-14H2,1-6H3/t16?,21-,26?,27+/m0/s1 |
| InChIKey | XIKQCDFWISOLJK-VQDJEFRQSA-N |
| XLogP | 4.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|